C17H23NO7 — CID 134568959
[2-(5-tert-butyl-2-methoxycarbonyloxy-4-nitrophenyl)-2-methylpropyl] formate (PubChem CID 134568959) has the molecular formula C17H23NO7 and a molecular weight of 353.37 g/mol. Its IUPAC name is [2-(5-tert-butyl-2-methoxycarbonyloxy-4-nitrophenyl)-2-methylpropyl] formate.
| Compound Name | [2-(5-tert-butyl-2-methoxycarbonyloxy-4-nitrophenyl)-2-methylpropyl] formate |
|---|---|
| PubChem CID | 134568959 |
| Molecular Formula | C17H23NO7 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | [2-(5-tert-butyl-2-methoxycarbonyloxy-4-nitrophenyl)-2-methylpropyl] formate |
| SMILES | COC(=O)Oc1cc([N+](=O)[O-])c(C(C)(C)C)cc1C(C)(C)COC=O |
| InChI | InChI=1S/C17H23NO7/c1-16(2,3)11-7-12(17(4,5)9-24-10-19)14(25-15(20)23-6)8-13(11)18(21)22/h7-8,10H,9H2,1-6H3 |
| InChIKey | SDCYHPNWQSJDMB-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|