C16H25NO2 — CID 150690637
1,5-ditert-butyl-2-ethyl-4-nitrobenzene (PubChem CID 150690637) has the molecular formula C16H25NO2 and a molecular weight of 263.38 g/mol. Its IUPAC name is 1,5-ditert-butyl-2-ethyl-4-nitrobenzene.
| Compound Name | 1,5-ditert-butyl-2-ethyl-4-nitrobenzene |
|---|---|
| PubChem CID | 150690637 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | 1,5-ditert-butyl-2-ethyl-4-nitrobenzene |
| SMILES | CCc1cc([N+](=O)[O-])c(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C16H25NO2/c1-8-11-9-14(17(18)19)13(16(5,6)7)10-12(11)15(2,3)4/h9-10H,8H2,1-7H3 |
| InChIKey | YJQNBJBOJJJAFS-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|