C10H13NO2 — CID 20695705
1-ethyl-2,4-dimethyl-5-nitrobenzene (PubChem CID 20695705) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is 1-ethyl-2,4-dimethyl-5-nitrobenzene.
| Compound Name | 1-ethyl-2,4-dimethyl-5-nitrobenzene |
|---|---|
| PubChem CID | 20695705 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 1-ethyl-2,4-dimethyl-5-nitrobenzene |
| SMILES | CCc1cc([N+](=O)[O-])c(C)cc1C |
| InChI | InChI=1S/C10H13NO2/c1-4-9-6-10(11(12)13)8(3)5-7(9)2/h5-6H,4H2,1-3H3 |
| InChIKey | HHBDDCSUMXKSPZ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|