C12H14BrNO4 — CID 160643930
[4-bromo-2-(1,1,1,3,3,3-hexadeuterio-2-methylpropan-2-yl)-5-nitrophenyl] acetate (PubChem CID 160643930) has the molecular formula C12H14BrNO4 and a molecular weight of 322.19 g/mol. Its IUPAC name is [4-bromo-2-(1,1,1,3,3,3-hexadeuterio-2-methylpropan-2-yl)-5-nitrophenyl] acetate.
| Compound Name | [4-bromo-2-(1,1,1,3,3,3-hexadeuterio-2-methylpropan-2-yl)-5-nitrophenyl] acetate |
|---|---|
| PubChem CID | 160643930 |
| Molecular Formula | C12H14BrNO4 |
| Molecular Weight | 322.19 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | [4-bromo-2-(1,1,1,3,3,3-hexadeuterio-2-methylpropan-2-yl)-5-nitrophenyl] acetate |
| SMILES | [2H]C([2H])([2H])C(C)(c1cc(Br)c([N+](=O)[O-])cc1OC(C)=O)C([2H])([2H])[2H] |
| InChI | InChI=1S/C12H14BrNO4/c1-7(15)18-11-6-10(14(16)17)9(13)5-8(11)12(2,3)4/h5-6H,1-4H3/i2D3,3D3 |
| InChIKey | HYEFRDRUWMDVIQ-XERRXZQWSA-N |
| XLogP | 3.58 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.19 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|