C16H22BrNO5 — CID 158877567
[2-bromo-4-tert-butyl-6-(1,1,1,3,3,3-hexadeuterio-2-methylpropan-2-yl)-3-nitrophenyl] methyl carbonate (PubChem CID 158877567) has the molecular formula C16H22BrNO5 and a molecular weight of 394.29 g/mol. Its IUPAC name is [2-bromo-4-tert-butyl-6-(1,1,1,3,3,3-hexadeuterio-2-methylpropan-2-yl)-3-nitrophenyl] methyl carbonate.
| Compound Name | [2-bromo-4-tert-butyl-6-(1,1,1,3,3,3-hexadeuterio-2-methylpropan-2-yl)-3-nitrophenyl] methyl carbonate |
|---|---|
| PubChem CID | 158877567 |
| Molecular Formula | C16H22BrNO5 |
| Molecular Weight | 394.29 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | [2-bromo-4-tert-butyl-6-(1,1,1,3,3,3-hexadeuterio-2-methylpropan-2-yl)-3-nitrophenyl] methyl carbonate |
| SMILES | [2H]C([2H])([2H])C(C)(c1cc(C(C)(C)C)c([N+](=O)[O-])c(Br)c1OC(=O)OC)C([2H])([2H])[2H] |
| InChI | InChI=1S/C16H22BrNO5/c1-15(2,3)9-8-10(16(4,5)6)13(23-14(19)22-7)11(17)12(9)18(20)21/h8H,1-7H3/i4D3,5D3 |
| InChIKey | AXUBFBBJAVLQOA-RKAHMFOGSA-N |
| XLogP | 5.10 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.29 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|