C10H13BrN2O5 — CID 66516371
(2R)-2-amino-2-(3-bromo-4,5-dimethoxy-2-nitrophenyl)ethanol (PubChem CID 66516371) has the molecular formula C10H13BrN2O5 and a molecular weight of 321.13 g/mol. Its IUPAC name is (2R)-2-amino-2-(3-bromo-4,5-dimethoxy-2-nitrophenyl)ethanol.
| Compound Name | (2R)-2-amino-2-(3-bromo-4,5-dimethoxy-2-nitrophenyl)ethanol |
|---|---|
| PubChem CID | 66516371 |
| Molecular Formula | C10H13BrN2O5 |
| Molecular Weight | 321.13 g/mol |
| Exact Mass | 320.00 |
| IUPAC Name | (2R)-2-amino-2-(3-bromo-4,5-dimethoxy-2-nitrophenyl)ethanol |
| SMILES | COc1cc([C@@H](N)CO)c([N+](=O)[O-])c(Br)c1OC |
| InChI | InChI=1S/C10H13BrN2O5/c1-17-7-3-5(6(12)4-14)9(13(15)16)8(11)10(7)18-2/h3,6,14H,4,12H2,1-2H3/t6-/m0/s1 |
| InChIKey | LFBGCQWQAIOELB-LURJTMIESA-N |
| XLogP | 1.37 |
| TPSA | 107.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.13 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|