C10H14BrN3O4 — CID 165352097
(1S)-1-(6-bromo-3,4-dimethoxy-2-nitrophenyl)ethane-1,2-diamine (PubChem CID 165352097) has the molecular formula C10H14BrN3O4 and a molecular weight of 320.14 g/mol. Its IUPAC name is (1S)-1-(6-bromo-3,4-dimethoxy-2-nitrophenyl)ethane-1,2-diamine.
| Compound Name | (1S)-1-(6-bromo-3,4-dimethoxy-2-nitrophenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 165352097 |
| Molecular Formula | C10H14BrN3O4 |
| Molecular Weight | 320.14 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | (1S)-1-(6-bromo-3,4-dimethoxy-2-nitrophenyl)ethane-1,2-diamine |
| SMILES | COc1cc(Br)c([C@H](N)CN)c([N+](=O)[O-])c1OC |
| InChI | InChI=1S/C10H14BrN3O4/c1-17-7-3-5(11)8(6(13)4-12)9(14(15)16)10(7)18-2/h3,6H,4,12-13H2,1-2H3/t6-/m1/s1 |
| InChIKey | BUWMODAXCZFLJW-ZCFIWIBFSA-N |
| XLogP | 1.33 |
| TPSA | 113.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.14 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|