C10H15BrN2O2 — CID 170894695
1-(3-bromo-4,5-dimethoxyphenyl)ethane-1,2-diamine (PubChem CID 170894695) has the molecular formula C10H15BrN2O2 and a molecular weight of 275.15 g/mol. Its IUPAC name is 1-(3-bromo-4,5-dimethoxyphenyl)ethane-1,2-diamine.
| Compound Name | 1-(3-bromo-4,5-dimethoxyphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 170894695 |
| Molecular Formula | C10H15BrN2O2 |
| Molecular Weight | 275.15 g/mol |
| Exact Mass | 274.03 |
| IUPAC Name | 1-(3-bromo-4,5-dimethoxyphenyl)ethane-1,2-diamine |
| SMILES | COc1cc(C(N)CN)cc(Br)c1OC |
| InChI | InChI=1S/C10H15BrN2O2/c1-14-9-4-6(8(13)5-12)3-7(11)10(9)15-2/h3-4,8H,5,12-13H2,1-2H3 |
| InChIKey | LFKXAOVGTSRHJU-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.15 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |