C9H11Br2NO2 — CID 66516252
(2R)-2-amino-2-(3,5-dibromo-4-methoxyphenyl)ethanol (PubChem CID 66516252) has the molecular formula C9H11Br2NO2 and a molecular weight of 325.00 g/mol. Its IUPAC name is (2R)-2-amino-2-(3,5-dibromo-4-methoxyphenyl)ethanol.
| Compound Name | (2R)-2-amino-2-(3,5-dibromo-4-methoxyphenyl)ethanol |
|---|---|
| PubChem CID | 66516252 |
| Molecular Formula | C9H11Br2NO2 |
| Molecular Weight | 325.00 g/mol |
| Exact Mass | 322.92 |
| IUPAC Name | (2R)-2-amino-2-(3,5-dibromo-4-methoxyphenyl)ethanol |
| SMILES | COc1c(Br)cc([C@@H](N)CO)cc1Br |
| InChI | InChI=1S/C9H11Br2NO2/c1-14-9-6(10)2-5(3-7(9)11)8(12)4-13/h2-3,8,13H,4,12H2,1H3/t8-/m0/s1 |
| InChIKey | VRYLZUSPHMTZMG-QMMMGPOBSA-N |
| XLogP | 2.21 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.00 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |