C12H15BrO3 — CID 117462993
3-(3-bromo-4,5-dimethoxyphenyl)butanal (PubChem CID 117462993) has the molecular formula C12H15BrO3 and a molecular weight of 287.15 g/mol. Its IUPAC name is 3-(3-bromo-4,5-dimethoxyphenyl)butanal.
| Compound Name | 3-(3-bromo-4,5-dimethoxyphenyl)butanal |
|---|---|
| PubChem CID | 117462993 |
| Molecular Formula | C12H15BrO3 |
| Molecular Weight | 287.15 g/mol |
| Exact Mass | 286.02 |
| IUPAC Name | 3-(3-bromo-4,5-dimethoxyphenyl)butanal |
| SMILES | COc1cc(C(C)CC=O)cc(Br)c1OC |
| InChI | InChI=1S/C12H15BrO3/c1-8(4-5-14)9-6-10(13)12(16-3)11(7-9)15-2/h5-8H,4H2,1-3H3 |
| InChIKey | XSVKEUDVKNEDAZ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.15 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|