C12H15BrO4 — CID 117487905
3-(3-bromo-2-hydroxy-4,5-dimethoxyphenyl)butanal (PubChem CID 117487905) has the molecular formula C12H15BrO4 and a molecular weight of 303.15 g/mol. Its IUPAC name is 3-(3-bromo-2-hydroxy-4,5-dimethoxyphenyl)butanal.
| Compound Name | 3-(3-bromo-2-hydroxy-4,5-dimethoxyphenyl)butanal |
|---|---|
| PubChem CID | 117487905 |
| Molecular Formula | C12H15BrO4 |
| Molecular Weight | 303.15 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | 3-(3-bromo-2-hydroxy-4,5-dimethoxyphenyl)butanal |
| SMILES | COc1cc(C(C)CC=O)c(O)c(Br)c1OC |
| InChI | InChI=1S/C12H15BrO4/c1-7(4-5-14)8-6-9(16-2)12(17-3)10(13)11(8)15/h5-7,15H,4H2,1-3H3 |
| InChIKey | AINWGUZQAAWQBS-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.15 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|