C12H18BrNO3 — CID 117489376
6-(4-aminobutan-2-yl)-2-bromo-3,4-dimethoxyphenol (PubChem CID 117489376) has the molecular formula C12H18BrNO3 and a molecular weight of 304.18 g/mol. Its IUPAC name is 6-(4-aminobutan-2-yl)-2-bromo-3,4-dimethoxyphenol.
| Compound Name | 6-(4-aminobutan-2-yl)-2-bromo-3,4-dimethoxyphenol |
|---|---|
| PubChem CID | 117489376 |
| Molecular Formula | C12H18BrNO3 |
| Molecular Weight | 304.18 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | 6-(4-aminobutan-2-yl)-2-bromo-3,4-dimethoxyphenol |
| SMILES | COc1cc(C(C)CCN)c(O)c(Br)c1OC |
| InChI | InChI=1S/C12H18BrNO3/c1-7(4-5-14)8-6-9(16-2)12(17-3)10(13)11(8)15/h6-7,15H,4-5,14H2,1-3H3 |
| InChIKey | KYRRLMWHYTWWSL-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.18 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |