C10H13BrO3 — CID 84710445
2-bromo-6-ethyl-3,4-dimethoxyphenol (PubChem CID 84710445) has the molecular formula C10H13BrO3 and a molecular weight of 261.11 g/mol. Its IUPAC name is 2-bromo-6-ethyl-3,4-dimethoxyphenol.
| Compound Name | 2-bromo-6-ethyl-3,4-dimethoxyphenol |
|---|---|
| PubChem CID | 84710445 |
| Molecular Formula | C10H13BrO3 |
| Molecular Weight | 261.11 g/mol |
| Exact Mass | 260.00 |
| IUPAC Name | 2-bromo-6-ethyl-3,4-dimethoxyphenol |
| SMILES | CCc1cc(OC)c(OC)c(Br)c1O |
| InChI | InChI=1S/C10H13BrO3/c1-4-6-5-7(13-2)10(14-3)8(11)9(6)12/h5,12H,4H2,1-3H3 |
| InChIKey | RMCDQTVBHZLQNF-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.11 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |