2-(3-bromo-2-fluoro-4,5-dimethoxyphenyl)acetic acid

C10H10BrFO4 — CID 117472876

IUPAC2-(3-bromo-2-fluoro-4,5-dimethoxyphenyl)acetic acid
SMILESCOc1cc(CC(=O)O)c(F)c(Br)c1OC
InChIInChI=1S/C10H10BrFO4/c1-15-6-3-5(4-7(13)14)9(12)8(11)10(6)16-2/h3H,4H2,1-2H3,(H,13,14)
InChIKeyLMTPGKIADRQQAQ-UHFFFAOYSA-N
MW293.09 g/mol
LogP2.23
Rot. Bonds4

About 2-(3-bromo-2-fluoro-4,5-dimethoxyphenyl)acetic acid

2-(3-bromo-2-fluoro-4,5-dimethoxyphenyl)acetic acid (PubChem CID 117472876) has the molecular formula C10H10BrFO4 and a molecular weight of 293.09 g/mol. Its IUPAC name is 2-(3-bromo-2-fluoro-4,5-dimethoxyphenyl)acetic acid.

Molecular Properties

Compound Name2-(3-bromo-2-fluoro-4,5-dimethoxyphenyl)acetic acid
PubChem CID117472876
Molecular FormulaC10H10BrFO4
Molecular Weight293.09 g/mol
Exact Mass291.97
IUPAC Name2-(3-bromo-2-fluoro-4,5-dimethoxyphenyl)acetic acid
SMILESCOc1cc(CC(=O)O)c(F)c(Br)c1OC
InChIInChI=1S/C10H10BrFO4/c1-15-6-3-5(4-7(13)14)9(12)8(11)10(6)16-2/h3H,4H2,1-2H3,(H,13,14)
InChIKeyLMTPGKIADRQQAQ-UHFFFAOYSA-N
XLogP2.23
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500293.09
LogP ≤ 52.23
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(3-bromo-2-fluoro-4,5-dimethoxyphenyl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3-bromo-2-fluoro-4,5-dimethoxyphenyl)acetic acid?
The IUPAC name of 2-(3-bromo-2-fluoro-4,5-dimethoxyphenyl)acetic acid (CID 117472876) is 2-(3-bromo-2-fluoro-4,5-dimethoxyphenyl)acetic acid.
What is the SMILES notation for 2-(3-bromo-2-fluoro-4,5-dimethoxyphenyl)acetic acid?
The canonical SMILES for 2-(3-bromo-2-fluoro-4,5-dimethoxyphenyl)acetic acid is COc1cc(CC(=O)O)c(F)c(Br)c1OC.
What is the InChIKey of 2-(3-bromo-2-fluoro-4,5-dimethoxyphenyl)acetic acid?
The InChIKey is LMTPGKIADRQQAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10BrFO4/c1-15-6-3-5(4-7(13)14)9(12)8(11)10(6)16-2/h3H,4H2,1-2H3,(H,13,14).
What are the key properties of 2-(3-bromo-2-fluoro-4,5-dimethoxyphenyl)acetic acid?
2-(3-bromo-2-fluoro-4,5-dimethoxyphenyl)acetic acid has a molecular weight of 293.09 g/mol, XLogP of 2.23, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-bromo-2-fluoro-4,5-dimethoxyphenyl)acetic acid is sourced from PubChem (CID 117472876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).