C11H15BrO3 — CID 84714156
(2-bromo-3-ethyl-5,6-dimethoxyphenyl)methanol (PubChem CID 84714156) has the molecular formula C11H15BrO3 and a molecular weight of 275.14 g/mol. Its IUPAC name is (2-bromo-3-ethyl-5,6-dimethoxyphenyl)methanol.
| Compound Name | (2-bromo-3-ethyl-5,6-dimethoxyphenyl)methanol |
|---|---|
| PubChem CID | 84714156 |
| Molecular Formula | C11H15BrO3 |
| Molecular Weight | 275.14 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | (2-bromo-3-ethyl-5,6-dimethoxyphenyl)methanol |
| SMILES | CCc1cc(OC)c(OC)c(CO)c1Br |
| InChI | InChI=1S/C11H15BrO3/c1-4-7-5-9(14-2)11(15-3)8(6-13)10(7)12/h5,13H,4,6H2,1-3H3 |
| InChIKey | QNOZAJCATRZTAA-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.14 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |