C11H16O5 — CID 71399833
[2-(hydroxymethyl)-3,4,5-trimethoxyphenyl]methanol (PubChem CID 71399833) has the molecular formula C11H16O5 and a molecular weight of 228.24 g/mol. Its IUPAC name is [2-(hydroxymethyl)-3,4,5-trimethoxyphenyl]methanol.
| Compound Name | [2-(hydroxymethyl)-3,4,5-trimethoxyphenyl]methanol |
|---|---|
| PubChem CID | 71399833 |
| Molecular Formula | C11H16O5 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | [2-(hydroxymethyl)-3,4,5-trimethoxyphenyl]methanol |
| SMILES | COc1cc(CO)c(CO)c(OC)c1OC |
| InChI | InChI=1S/C11H16O5/c1-14-9-4-7(5-12)8(6-13)10(15-2)11(9)16-3/h4,12-13H,5-6H2,1-3H3 |
| InChIKey | RVXRHTANUORMLI-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |