C9H12O5 — CID 149144682
4-(hydroxymethyl)-2,6-dimethoxybenzene-1,3-diol (PubChem CID 149144682) has the molecular formula C9H12O5 and a molecular weight of 200.19 g/mol. Its IUPAC name is 4-(hydroxymethyl)-2,6-dimethoxybenzene-1,3-diol.
| Compound Name | 4-(hydroxymethyl)-2,6-dimethoxybenzene-1,3-diol |
|---|---|
| PubChem CID | 149144682 |
| Molecular Formula | C9H12O5 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | 4-(hydroxymethyl)-2,6-dimethoxybenzene-1,3-diol |
| SMILES | COc1cc(CO)c(O)c(OC)c1O |
| InChI | InChI=1S/C9H12O5/c1-13-6-3-5(4-10)7(11)9(14-2)8(6)12/h3,10-12H,4H2,1-2H3 |
| InChIKey | RJPQDCOGINEPEB-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |