C27H36O6 — CID 158471332
[6-(hydroxymethyl)-4',5',6',7-tetramethoxy-1',1',3,3-tetramethyl-1,3'-spirobi[2H-indene]-5-yl]methanol (PubChem CID 158471332) has the molecular formula C27H36O6 and a molecular weight of 456.58 g/mol. Its IUPAC name is [6-(hydroxymethyl)-4',5',6',7-tetramethoxy-1',1',3,3-tetramethyl-1,3'-spirobi[2H-indene]-5-yl]methanol.
| Compound Name | [6-(hydroxymethyl)-4',5',6',7-tetramethoxy-1',1',3,3-tetramethyl-1,3'-spirobi[2H-indene]-5-yl]methanol |
|---|---|
| PubChem CID | 158471332 |
| Molecular Formula | C27H36O6 |
| Molecular Weight | 456.58 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | [6-(hydroxymethyl)-4',5',6',7-tetramethoxy-1',1',3,3-tetramethyl-1,3'-spirobi[2H-indene]-5-yl]methanol |
| SMILES | COc1cc2c(c(OC)c1OC)C1(CC(C)(C)c3cc(CO)c(CO)c(OC)c31)CC2(C)C |
| InChI | InChI=1S/C27H36O6/c1-25(2)13-27(20-17(25)9-15(11-28)16(12-29)22(20)31-6)14-26(3,4)18-10-19(30-5)23(32-7)24(33-8)21(18)27/h9-10,28-29H,11-14H2,1-8H3 |
| InChIKey | OZYWJPZTUNSIMV-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.58 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |