C23H28O6 — CID 102292804
6,6'-dimethoxy-3,3,3',3'-tetramethyl-1,1'-spirobi[2H-indene]-4,4',5,5'-tetrol (PubChem CID 102292804) has the molecular formula C23H28O6 and a molecular weight of 400.47 g/mol. Its IUPAC name is 6,6'-dimethoxy-3,3,3',3'-tetramethyl-1,1'-spirobi[2H-indene]-4,4',5,5'-tetrol.
| Compound Name | 6,6'-dimethoxy-3,3,3',3'-tetramethyl-1,1'-spirobi[2H-indene]-4,4',5,5'-tetrol |
|---|---|
| PubChem CID | 102292804 |
| Molecular Formula | C23H28O6 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 6,6'-dimethoxy-3,3,3',3'-tetramethyl-1,1'-spirobi[2H-indene]-4,4',5,5'-tetrol |
| SMILES | COc1cc2c(c(O)c1O)C(C)(C)CC21CC(C)(C)c2c1cc(OC)c(O)c2O |
| InChI | InChI=1S/C23H28O6/c1-21(2)9-23(11-7-13(28-5)17(24)19(26)15(11)21)10-22(3,4)16-12(23)8-14(29-6)18(25)20(16)27/h7-8,24-27H,9-10H2,1-6H3 |
| InChIKey | MULHSQFQBAMSSW-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|