C37H56O4 — CID 19356780
1,1,1',1'-tetramethyl-6,6'-dioctoxy-3,3'-spirobi[2H-indene]-5,5'-diol (PubChem CID 19356780) has the molecular formula C37H56O4 and a molecular weight of 564.85 g/mol. Its IUPAC name is 1,1,1',1'-tetramethyl-6,6'-dioctoxy-3,3'-spirobi[2H-indene]-5,5'-diol.
| Compound Name | 1,1,1',1'-tetramethyl-6,6'-dioctoxy-3,3'-spirobi[2H-indene]-5,5'-diol |
|---|---|
| PubChem CID | 19356780 |
| Molecular Formula | C37H56O4 |
| Molecular Weight | 564.85 g/mol |
| Exact Mass | 564.42 |
| IUPAC Name | 1,1,1',1'-tetramethyl-6,6'-dioctoxy-3,3'-spirobi[2H-indene]-5,5'-diol |
| SMILES | CCCCCCCCOc1cc2c(cc1O)C1(CC2(C)C)CC(C)(C)c2cc(OCCCCCCCC)c(O)cc21 |
| InChI | InChI=1S/C37H56O4/c1-7-9-11-13-15-17-19-40-33-23-27-29(21-31(33)38)37(25-35(27,3)4)26-36(5,6)28-24-34(32(39)22-30(28)37)41-20-18-16-14-12-10-8-2/h21-24,38-39H,7-20,25-26H2,1-6H3 |
| InChIKey | AYTXABKCVZXFQD-UHFFFAOYSA-N |
| XLogP | 10.23 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.85 |
| LogP ≤ 5 | 10.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|