C51H66O6 — CID 102047434
6,15,24-trioctoxyheptacyclo[18.7.0.02,10.03,8.011,19.012,17.021,26]heptacosa-1,3,5,7,10,12,14,16,19,21,23,25-dodecaene-5,14,23-triol (PubChem CID 102047434) has the molecular formula C51H66O6 and a molecular weight of 775.08 g/mol. Its IUPAC name is 6,15,24-trioctoxyheptacyclo[18.7.0.02,10.03,8.011,19.012,17.021,26]heptacosa-1,3,5,7,10,12,14,16,19,21,23,25-dodecaene-5,14,23-triol.
| Compound Name | 6,15,24-trioctoxyheptacyclo[18.7.0.02,10.03,8.011,19.012,17.021,26]heptacosa-1,3,5,7,10,12,14,16,19,21,23,25-dodecaene-5,14,23-triol |
|---|---|
| PubChem CID | 102047434 |
| Molecular Formula | C51H66O6 |
| Molecular Weight | 775.08 g/mol |
| Exact Mass | 774.49 |
| IUPAC Name | 6,15,24-trioctoxyheptacyclo[18.7.0.02,10.03,8.011,19.012,17.021,26]heptacosa-1,3,5,7,10,12,14,16,19,21,23,25-dodecaene-5,14,23-triol |
| SMILES | CCCCCCCCOc1cc2c(cc1O)-c1c(c3c(c4c1Cc1cc(OCCCCCCCC)c(O)cc1-4)Cc1cc(OCCCCCCCC)c(O)cc1-3)C2 |
| InChI | InChI=1S/C51H66O6/c1-4-7-10-13-16-19-22-55-46-28-34-25-40-49(37(34)31-43(46)52)41-26-35-29-47(56-23-20-17-14-11-8-5-2)45(54)33-39(35)51(41)42-27-36-30-48(44(53)32-38(36)50(40)42)57-24-21-18-15-12-9-6-3/h28-33,52-54H,4-27H2,1-3H3 |
| InChIKey | BXKRUSLENJALIM-UHFFFAOYSA-N |
| XLogP | 13.73 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.08 |
| LogP ≤ 5 | 13.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|