C81H135N3O9 — CID 136913141
2-[4,6-bis(4,5-didecoxy-2-hydroxyphenyl)-1,3,5-triazin-2-yl]-4,5-didecoxyphenol (PubChem CID 136913141) has the molecular formula C81H135N3O9 and a molecular weight of 1294.98 g/mol. Its IUPAC name is 2-[4,6-bis(4,5-didecoxy-2-hydroxyphenyl)-1,3,5-triazin-2-yl]-4,5-didecoxyphenol.
| Compound Name | 2-[4,6-bis(4,5-didecoxy-2-hydroxyphenyl)-1,3,5-triazin-2-yl]-4,5-didecoxyphenol |
|---|---|
| PubChem CID | 136913141 |
| Molecular Formula | C81H135N3O9 |
| Molecular Weight | 1294.98 g/mol |
| Exact Mass | 1294.02 |
| IUPAC Name | 2-[4,6-bis(4,5-didecoxy-2-hydroxyphenyl)-1,3,5-triazin-2-yl]-4,5-didecoxyphenol |
| SMILES | CCCCCCCCCCOc1cc(O)c(-c2nc(-c3cc(OCCCCCCCCCC)c(OCCCCCCCCCC)cc3O)nc(-c3cc(OCCCCCCCCCC)c(OCCCCCCCCCC)cc3O)n2)cc1OCCCCCCCCCC |
| InChI | InChI=1S/C81H135N3O9/c1-7-13-19-25-31-37-43-49-55-88-73-61-67(70(85)64-76(73)91-58-52-46-40-34-28-22-16-10-4)79-82-80(68-62-74(89-56-50-44-38-32-26-20-14-8-2)77(65-71(68)86)92-59-53-47-41-35-29-23-17-11-5)84-81(83-79)69-63-75(90-57-51-45-39-33-27-21-15-9-3)78(66-72(69)87)93-60-54-48-42-36-30-24-18-12-6/h61-66,85-87H,7-60H2,1-6H3 |
| InChIKey | IXLDKKXTTOLNEO-UHFFFAOYSA-N |
| XLogP | 25.11 |
| TPSA | 154.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 63 |
| Heavy Atoms | 93 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1294.98 |
| LogP ≤ 5 | 25.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|