C43H59N3O2 — CID 135740037
2-[4,6-bis(4-tert-butylphenyl)-1,3,5-triazin-2-yl]-4-hexyl-5-octoxyphenol (PubChem CID 135740037) has the molecular formula C43H59N3O2 and a molecular weight of 649.96 g/mol. Its IUPAC name is 2-[4,6-bis(4-tert-butylphenyl)-1,3,5-triazin-2-yl]-4-hexyl-5-octoxyphenol.
| Compound Name | 2-[4,6-bis(4-tert-butylphenyl)-1,3,5-triazin-2-yl]-4-hexyl-5-octoxyphenol |
|---|---|
| PubChem CID | 135740037 |
| Molecular Formula | C43H59N3O2 |
| Molecular Weight | 649.96 g/mol |
| Exact Mass | 649.46 |
| IUPAC Name | 2-[4,6-bis(4-tert-butylphenyl)-1,3,5-triazin-2-yl]-4-hexyl-5-octoxyphenol |
| SMILES | CCCCCCCCOc1cc(O)c(-c2nc(-c3ccc(C(C)(C)C)cc3)nc(-c3ccc(C(C)(C)C)cc3)n2)cc1CCCCCC |
| InChI | InChI=1S/C43H59N3O2/c1-9-11-13-15-16-18-28-48-38-30-37(47)36(29-33(38)19-17-14-12-10-2)41-45-39(31-20-24-34(25-21-31)42(3,4)5)44-40(46-41)32-22-26-35(27-23-32)43(6,7)8/h20-27,29-30,47H,9-19,28H2,1-8H3 |
| InChIKey | WAMFJFYOFUTAOG-UHFFFAOYSA-N |
| XLogP | 12.04 |
| TPSA | 68.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.96 |
| LogP ≤ 5 | 12.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|