C38H58O4 — CID 141165582
1,2-bis(5-tert-butyl-2-octoxyphenyl)ethane-1,2-dione (PubChem CID 141165582) has the molecular formula C38H58O4 and a molecular weight of 578.88 g/mol. Its IUPAC name is 1,2-bis(5-tert-butyl-2-octoxyphenyl)ethane-1,2-dione.
| Compound Name | 1,2-bis(5-tert-butyl-2-octoxyphenyl)ethane-1,2-dione |
|---|---|
| PubChem CID | 141165582 |
| Molecular Formula | C38H58O4 |
| Molecular Weight | 578.88 g/mol |
| Exact Mass | 578.43 |
| IUPAC Name | 1,2-bis(5-tert-butyl-2-octoxyphenyl)ethane-1,2-dione |
| SMILES | CCCCCCCCOc1ccc(C(C)(C)C)cc1C(=O)C(=O)c1cc(C(C)(C)C)ccc1OCCCCCCCC |
| InChI | InChI=1S/C38H58O4/c1-9-11-13-15-17-19-25-41-33-23-21-29(37(3,4)5)27-31(33)35(39)36(40)32-28-30(38(6,7)8)22-24-34(32)42-26-20-18-16-14-12-10-2/h21-24,27-28H,9-20,25-26H2,1-8H3 |
| InChIKey | MOKFEGBDUJFZHL-UHFFFAOYSA-N |
| XLogP | 10.83 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.88 |
| LogP ≤ 5 | 10.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|