C42H58O2 — CID 102415017
4-tert-butyl-2-[(E)-2-[4-[(E)-2-(5-tert-butyl-2-hexoxyphenyl)ethenyl]phenyl]ethenyl]-1-hexoxybenzene (PubChem CID 102415017) has the molecular formula C42H58O2 and a molecular weight of 594.92 g/mol. Its IUPAC name is 4-tert-butyl-2-[(E)-2-[4-[(E)-2-(5-tert-butyl-2-hexoxyphenyl)ethenyl]phenyl]ethenyl]-1-hexoxybenzene.
| Compound Name | 4-tert-butyl-2-[(E)-2-[4-[(E)-2-(5-tert-butyl-2-hexoxyphenyl)ethenyl]phenyl]ethenyl]-1-hexoxybenzene |
|---|---|
| PubChem CID | 102415017 |
| Molecular Formula | C42H58O2 |
| Molecular Weight | 594.92 g/mol |
| Exact Mass | 594.44 |
| IUPAC Name | 4-tert-butyl-2-[(E)-2-[4-[(E)-2-(5-tert-butyl-2-hexoxyphenyl)ethenyl]phenyl]ethenyl]-1-hexoxybenzene |
| SMILES | CCCCCCOc1ccc(C(C)(C)C)cc1/C=C/c1ccc(/C=C/c2cc(C(C)(C)C)ccc2OCCCCCC)cc1 |
| InChI | InChI=1S/C42H58O2/c1-9-11-13-15-29-43-39-27-25-37(41(3,4)5)31-35(39)23-21-33-17-19-34(20-18-33)22-24-36-32-38(42(6,7)8)26-28-40(36)44-30-16-14-12-10-2/h17-28,31-32H,9-16,29-30H2,1-8H3/b23-21+,24-22+ |
| InChIKey | OURJPVFMHYRXEP-MBALSZOMSA-N |
| XLogP | 12.54 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.92 |
| LogP ≤ 5 | 12.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|