C79H106O7 — CID 42624735
tris[4-[(E)-2-(3,4-dihexoxyphenyl)ethenyl]phenyl]methanol (PubChem CID 42624735) has the molecular formula C79H106O7 and a molecular weight of 1167.71 g/mol. Its IUPAC name is tris[4-[(E)-2-(3,4-dihexoxyphenyl)ethenyl]phenyl]methanol.
| Compound Name | tris[4-[(E)-2-(3,4-dihexoxyphenyl)ethenyl]phenyl]methanol |
|---|---|
| PubChem CID | 42624735 |
| Molecular Formula | C79H106O7 |
| Molecular Weight | 1167.71 g/mol |
| Exact Mass | 1166.79 |
| IUPAC Name | tris[4-[(E)-2-(3,4-dihexoxyphenyl)ethenyl]phenyl]methanol |
| SMILES | CCCCCCOc1ccc(/C=C/c2ccc(C(O)(c3ccc(/C=C/c4ccc(OCCCCCC)c(OCCCCCC)c4)cc3)c3ccc(/C=C/c4ccc(OCCCCCC)c(OCCCCCC)c4)cc3)cc2)cc1OCCCCCC |
| InChI | InChI=1S/C79H106O7/c1-7-13-19-25-55-81-73-52-43-67(61-76(73)84-58-28-22-16-10-4)34-31-64-37-46-70(47-38-64)79(80,71-48-39-65(40-49-71)32-35-68-44-53-74(82-56-26-20-14-8-2)77(62-68)85-59-29-23-17-11-5)72-50-41-66(42-51-72)33-36-69-45-54-75(83-57-27-21-15-9-3)78(63-69)86-60-30-24-18-12-6/h31-54,61-63,80H,7-30,55-60H2,1-6H3/b34-31+,35-32+,36-33+ |
| InChIKey | MFZYGCWJCHCIIO-JCLOTSFOSA-N |
| XLogP | 22.24 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 86 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1167.71 |
| LogP ≤ 5 | 22.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|