C20H24O2 — CID 102312295
2-methoxy-1-pentoxy-4-[(E)-2-phenylethenyl]benzene (PubChem CID 102312295) has the molecular formula C20H24O2 and a molecular weight of 296.41 g/mol. Its IUPAC name is 2-methoxy-1-pentoxy-4-[(E)-2-phenylethenyl]benzene.
| Compound Name | 2-methoxy-1-pentoxy-4-[(E)-2-phenylethenyl]benzene |
|---|---|
| PubChem CID | 102312295 |
| Molecular Formula | C20H24O2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | 2-methoxy-1-pentoxy-4-[(E)-2-phenylethenyl]benzene |
| SMILES | CCCCCOc1ccc(/C=C/c2ccccc2)cc1OC |
| InChI | InChI=1S/C20H24O2/c1-3-4-8-15-22-19-14-13-18(16-20(19)21-2)12-11-17-9-6-5-7-10-17/h5-7,9-14,16H,3-4,8,15H2,1-2H3/b12-11+ |
| InChIKey | NHYOMQZVHXQBAE-VAWYXSNFSA-N |
| XLogP | 5.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|