C31H39NO5 — CID 46947065
3,5-bis[(E)-2-(3-methoxy-4-pentoxyphenyl)ethenyl]-1,2-oxazole (PubChem CID 46947065) has the molecular formula C31H39NO5 and a molecular weight of 505.66 g/mol. Its IUPAC name is 3,5-bis[(E)-2-(3-methoxy-4-pentoxyphenyl)ethenyl]-1,2-oxazole.
| Compound Name | 3,5-bis[(E)-2-(3-methoxy-4-pentoxyphenyl)ethenyl]-1,2-oxazole |
|---|---|
| PubChem CID | 46947065 |
| Molecular Formula | C31H39NO5 |
| Molecular Weight | 505.66 g/mol |
| Exact Mass | 505.28 |
| IUPAC Name | 3,5-bis[(E)-2-(3-methoxy-4-pentoxyphenyl)ethenyl]-1,2-oxazole |
| SMILES | CCCCCOc1ccc(/C=C/c2cc(/C=C/c3ccc(OCCCCC)c(OC)c3)on2)cc1OC |
| InChI | InChI=1S/C31H39NO5/c1-5-7-9-19-35-28-17-13-24(21-30(28)33-3)11-15-26-23-27(37-32-26)16-12-25-14-18-29(31(22-25)34-4)36-20-10-8-6-2/h11-18,21-23H,5-10,19-20H2,1-4H3/b15-11+,16-12+ |
| InChIKey | CUPAQZUQTPJOCI-JOBJLJCHSA-N |
| XLogP | 8.17 |
| TPSA | 62.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.66 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|