C38H52N2O4 — CID 102253343
1-(3-methoxy-4-octoxyphenyl)-N-[4-[(3-methoxy-4-octoxyphenyl)methylideneamino]phenyl]methanimine (PubChem CID 102253343) has the molecular formula C38H52N2O4 and a molecular weight of 600.84 g/mol. Its IUPAC name is 1-(3-methoxy-4-octoxyphenyl)-N-[4-[(3-methoxy-4-octoxyphenyl)methylideneamino]phenyl]methanimine.
| Compound Name | 1-(3-methoxy-4-octoxyphenyl)-N-[4-[(3-methoxy-4-octoxyphenyl)methylideneamino]phenyl]methanimine |
|---|---|
| PubChem CID | 102253343 |
| Molecular Formula | C38H52N2O4 |
| Molecular Weight | 600.84 g/mol |
| Exact Mass | 600.39 |
| IUPAC Name | 1-(3-methoxy-4-octoxyphenyl)-N-[4-[(3-methoxy-4-octoxyphenyl)methylideneamino]phenyl]methanimine |
| SMILES | CCCCCCCCOc1ccc(/C=N/c2ccc(/N=C/c3ccc(OCCCCCCCC)c(OC)c3)cc2)cc1OC |
| InChI | InChI=1S/C38H52N2O4/c1-5-7-9-11-13-15-25-43-35-23-17-31(27-37(35)41-3)29-39-33-19-21-34(22-20-33)40-30-32-18-24-36(38(28-32)42-4)44-26-16-14-12-10-8-6-2/h17-24,27-30H,5-16,25-26H2,1-4H3/b39-29+,40-30+ |
| InChIKey | VRDNKQOACVYGIT-NXRKLTDKSA-N |
| XLogP | 10.68 |
| TPSA | 61.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.84 |
| LogP ≤ 5 | 10.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|