C14H21NO3 — CID 20986617
N-[(3-hexoxy-4-methoxyphenyl)methylidene]hydroxylamine (PubChem CID 20986617) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is N-[(3-hexoxy-4-methoxyphenyl)methylidene]hydroxylamine.
| Compound Name | N-[(3-hexoxy-4-methoxyphenyl)methylidene]hydroxylamine |
|---|---|
| PubChem CID | 20986617 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | N-[(3-hexoxy-4-methoxyphenyl)methylidene]hydroxylamine |
| SMILES | CCCCCCOc1cc(C=NO)ccc1OC |
| InChI | InChI=1S/C14H21NO3/c1-3-4-5-6-9-18-14-10-12(11-15-16)7-8-13(14)17-2/h7-8,10-11,16H,3-6,9H2,1-2H3 |
| InChIKey | ZWPMIEXUSFFOAW-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|