C23H32N8O4 — CID 21195025
2-[(E)-[3-[5-[5-[(E)-(diaminomethylidenehydrazinylidene)methyl]-2-methoxyphenoxy]pentoxy]-4-methoxyphenyl]methylideneamino]guanidine (PubChem CID 21195025) has the molecular formula C23H32N8O4 and a molecular weight of 484.56 g/mol. Its IUPAC name is 2-[(E)-[3-[5-[5-[(E)-(diaminomethylidenehydrazinylidene)methyl]-2-methoxyphenoxy]pentoxy]-4-methoxyphenyl]methylideneamino]guanidine.
| Compound Name | 2-[(E)-[3-[5-[5-[(E)-(diaminomethylidenehydrazinylidene)methyl]-2-methoxyphenoxy]pentoxy]-4-methoxyphenyl]methylideneamino]guanidine |
|---|---|
| PubChem CID | 21195025 |
| Molecular Formula | C23H32N8O4 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.25 |
| IUPAC Name | 2-[(E)-[3-[5-[5-[(E)-(diaminomethylidenehydrazinylidene)methyl]-2-methoxyphenoxy]pentoxy]-4-methoxyphenyl]methylideneamino]guanidine |
| SMILES | COc1ccc(/C=N/N=C(N)N)cc1OCCCCCOc1cc(/C=N/N=C(N)N)ccc1OC |
| InChI | InChI=1S/C23H32N8O4/c1-32-18-8-6-16(14-28-30-22(24)25)12-20(18)34-10-4-3-5-11-35-21-13-17(7-9-19(21)33-2)15-29-31-23(26)27/h6-9,12-15H,3-5,10-11H2,1-2H3,(H4,24,25,30)(H4,26,27,31)/b28-14+,29-15+ |
| InChIKey | HCXQJEDVHIWQCS-RABJZLPGSA-N |
| XLogP | 1.55 |
| TPSA | 190.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|