C16H16FNO4 — CID 20992695
N-[[3-[2-(4-fluorophenoxy)ethoxy]-4-methoxyphenyl]methylidene]hydroxylamine (PubChem CID 20992695) has the molecular formula C16H16FNO4 and a molecular weight of 305.31 g/mol. Its IUPAC name is N-[[3-[2-(4-fluorophenoxy)ethoxy]-4-methoxyphenyl]methylidene]hydroxylamine.
| Compound Name | N-[[3-[2-(4-fluorophenoxy)ethoxy]-4-methoxyphenyl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 20992695 |
| Molecular Formula | C16H16FNO4 |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | N-[[3-[2-(4-fluorophenoxy)ethoxy]-4-methoxyphenyl]methylidene]hydroxylamine |
| SMILES | COc1ccc(C=NO)cc1OCCOc1ccc(F)cc1 |
| InChI | InChI=1S/C16H16FNO4/c1-20-15-7-2-12(11-18-19)10-16(15)22-9-8-21-14-5-3-13(17)4-6-14/h2-7,10-11,19H,8-9H2,1H3 |
| InChIKey | RAUNHTGTXVIMNM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 60.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|