C16H15BrFNO4 — CID 20987045
N-[[5-bromo-2-[2-(4-fluorophenoxy)ethoxy]-3-methoxyphenyl]methylidene]hydroxylamine (PubChem CID 20987045) has the molecular formula C16H15BrFNO4 and a molecular weight of 384.20 g/mol. Its IUPAC name is N-[[5-bromo-2-[2-(4-fluorophenoxy)ethoxy]-3-methoxyphenyl]methylidene]hydroxylamine.
| Compound Name | N-[[5-bromo-2-[2-(4-fluorophenoxy)ethoxy]-3-methoxyphenyl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 20987045 |
| Molecular Formula | C16H15BrFNO4 |
| Molecular Weight | 384.20 g/mol |
| Exact Mass | 383.02 |
| IUPAC Name | N-[[5-bromo-2-[2-(4-fluorophenoxy)ethoxy]-3-methoxyphenyl]methylidene]hydroxylamine |
| SMILES | COc1cc(Br)cc(C=NO)c1OCCOc1ccc(F)cc1 |
| InChI | InChI=1S/C16H15BrFNO4/c1-21-15-9-12(17)8-11(10-19-20)16(15)23-7-6-22-14-4-2-13(18)3-5-14/h2-5,8-10,20H,6-7H2,1H3 |
| InChIKey | NFNAXCYLSSSDPI-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 60.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.20 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|