C18H21NO4 — CID 42337499
(NE)-N-[[2-[2-(3,5-dimethylphenoxy)ethoxy]-3-methoxyphenyl]methylidene]hydroxylamine (PubChem CID 42337499) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is (NE)-N-[[2-[2-(3,5-dimethylphenoxy)ethoxy]-3-methoxyphenyl]methylidene]hydroxylamine.
| Compound Name | (NE)-N-[[2-[2-(3,5-dimethylphenoxy)ethoxy]-3-methoxyphenyl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 42337499 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | (NE)-N-[[2-[2-(3,5-dimethylphenoxy)ethoxy]-3-methoxyphenyl]methylidene]hydroxylamine |
| SMILES | COc1cccc(/C=N/O)c1OCCOc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C18H21NO4/c1-13-9-14(2)11-16(10-13)22-7-8-23-18-15(12-19-20)5-4-6-17(18)21-3/h4-6,9-12,20H,7-8H2,1-3H3/b19-12+ |
| InChIKey | GYIGNZXGMNZPRT-XDHOZWIPSA-N |
| XLogP | 3.58 |
| TPSA | 60.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|