C11H11NO3 — CID 10104391
(NE)-N-[(3-methoxy-2-prop-2-ynoxyphenyl)methylidene]hydroxylamine (PubChem CID 10104391) has the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. Its IUPAC name is (NE)-N-[(3-methoxy-2-prop-2-ynoxyphenyl)methylidene]hydroxylamine.
| Compound Name | (NE)-N-[(3-methoxy-2-prop-2-ynoxyphenyl)methylidene]hydroxylamine |
|---|---|
| PubChem CID | 10104391 |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | (NE)-N-[(3-methoxy-2-prop-2-ynoxyphenyl)methylidene]hydroxylamine |
| SMILES | C#CCOc1c(/C=N/O)cccc1OC |
| InChI | InChI=1S/C11H11NO3/c1-3-7-15-11-9(8-12-13)5-4-6-10(11)14-2/h1,4-6,8,13H,7H2,2H3/b12-8+ |
| InChIKey | PPMBPOVPLWWJPN-XYOKQWHBSA-N |
| XLogP | 1.52 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|