C16H23NO4 — CID 19170401
1-heptoxy-2-methoxy-4-[(E)-2-nitroethenyl]benzene (PubChem CID 19170401) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is 1-heptoxy-2-methoxy-4-[(E)-2-nitroethenyl]benzene.
| Compound Name | 1-heptoxy-2-methoxy-4-[(E)-2-nitroethenyl]benzene |
|---|---|
| PubChem CID | 19170401 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 1-heptoxy-2-methoxy-4-[(E)-2-nitroethenyl]benzene |
| SMILES | CCCCCCCOc1ccc(/C=C/[N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C16H23NO4/c1-3-4-5-6-7-12-21-15-9-8-14(10-11-17(18)19)13-16(15)20-2/h8-11,13H,3-7,12H2,1-2H3/b11-10+ |
| InChIKey | CNLIJIZZXXFSPO-ZHACJKMWSA-N |
| XLogP | 4.29 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|