C22H26O3 — CID 134814022
(E)-3-(4-hexoxy-3-methoxyphenyl)-1-phenylprop-2-en-1-one (PubChem CID 134814022) has the molecular formula C22H26O3 and a molecular weight of 338.45 g/mol. Its IUPAC name is (E)-3-(4-hexoxy-3-methoxyphenyl)-1-phenylprop-2-en-1-one.
| Compound Name | (E)-3-(4-hexoxy-3-methoxyphenyl)-1-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 134814022 |
| Molecular Formula | C22H26O3 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | (E)-3-(4-hexoxy-3-methoxyphenyl)-1-phenylprop-2-en-1-one |
| SMILES | CCCCCCOc1ccc(/C=C/C(=O)c2ccccc2)cc1OC |
| InChI | InChI=1S/C22H26O3/c1-3-4-5-9-16-25-21-15-13-18(17-22(21)24-2)12-14-20(23)19-10-7-6-8-11-19/h6-8,10-15,17H,3-5,9,16H2,1-2H3/b14-12+ |
| InChIKey | OCQHXAGLTRIOJG-WYMLVPIESA-N |
| XLogP | 5.55 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|