C18H25NO5 — CID 102534546
2-[[(E)-3-(4-hexoxy-3-methoxyphenyl)prop-2-enoyl]amino]acetic acid (PubChem CID 102534546) has the molecular formula C18H25NO5 and a molecular weight of 335.40 g/mol. Its IUPAC name is 2-[[(E)-3-(4-hexoxy-3-methoxyphenyl)prop-2-enoyl]amino]acetic acid.
| Compound Name | 2-[[(E)-3-(4-hexoxy-3-methoxyphenyl)prop-2-enoyl]amino]acetic acid |
|---|---|
| PubChem CID | 102534546 |
| Molecular Formula | C18H25NO5 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 2-[[(E)-3-(4-hexoxy-3-methoxyphenyl)prop-2-enoyl]amino]acetic acid |
| SMILES | CCCCCCOc1ccc(/C=C/C(=O)NCC(=O)O)cc1OC |
| InChI | InChI=1S/C18H25NO5/c1-3-4-5-6-11-24-15-9-7-14(12-16(15)23-2)8-10-17(20)19-13-18(21)22/h7-10,12H,3-6,11,13H2,1-2H3,(H,19,20)(H,21,22)/b10-8+ |
| InChIKey | KYNKSQHZQZTNNM-CSKARUKUSA-N |
| XLogP | 2.87 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|