C15H19NO7 — CID 175897427
3-[3-methoxy-4-(5-nitrooxypentoxy)phenyl]prop-2-enoic acid (PubChem CID 175897427) has the molecular formula C15H19NO7 and a molecular weight of 325.32 g/mol. Its IUPAC name is 3-[3-methoxy-4-(5-nitrooxypentoxy)phenyl]prop-2-enoic acid.
| Compound Name | 3-[3-methoxy-4-(5-nitrooxypentoxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 175897427 |
| Molecular Formula | C15H19NO7 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 3-[3-methoxy-4-(5-nitrooxypentoxy)phenyl]prop-2-enoic acid |
| SMILES | COc1cc(C=CC(=O)O)ccc1OCCCCCO[N+](=O)[O-] |
| InChI | InChI=1S/C15H19NO7/c1-21-14-11-12(6-8-15(17)18)5-7-13(14)22-9-3-2-4-10-23-16(19)20/h5-8,11H,2-4,9-10H2,1H3,(H,17,18) |
| InChIKey | BEXBESSFBNACBZ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|