C34H47ClO8 — CID 162255990
(E)-3-(4-butoxy-3-methoxyphenyl)prop-2-enoic acid;6-chlorohexyl (E)-3-(4-butoxy-3-methoxyphenyl)prop-2-enoate (PubChem CID 162255990) has the molecular formula C34H47ClO8 and a molecular weight of 619.20 g/mol. Its IUPAC name is (E)-3-(4-butoxy-3-methoxyphenyl)prop-2-enoic acid;6-chlorohexyl (E)-3-(4-butoxy-3-methoxyphenyl)prop-2-enoate.
| Compound Name | (E)-3-(4-butoxy-3-methoxyphenyl)prop-2-enoic acid;6-chlorohexyl (E)-3-(4-butoxy-3-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 162255990 |
| Molecular Formula | C34H47ClO8 |
| Molecular Weight | 619.20 g/mol |
| Exact Mass | 618.30 |
| IUPAC Name | (E)-3-(4-butoxy-3-methoxyphenyl)prop-2-enoic acid;6-chlorohexyl (E)-3-(4-butoxy-3-methoxyphenyl)prop-2-enoate |
| SMILES | CCCCOc1ccc(/C=C/C(=O)O)cc1OC.CCCCOc1ccc(/C=C/C(=O)OCCCCCCCl)cc1OC |
| InChI | InChI=1S/C20H29ClO4.C14H18O4/c1-3-4-14-24-18-11-9-17(16-19(18)23-2)10-12-20(22)25-15-8-6-5-7-13-21;1-3-4-9-18-12-7-5-11(6-8-14(15)16)10-13(12)17-2/h9-12,16H,3-8,13-15H2,1-2H3;5-8,10H,3-4,9H2,1-2H3,(H,15,16)/b12-10+;8-6+ |
| InChIKey | ZYPHTQVDEBOHSH-BCCYBUEXSA-N |
| XLogP | 8.20 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.20 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|