C21H24O4S — CID 3710207
3-[3-methoxy-4-[4-(4-methylphenyl)sulfanylbutoxy]phenyl]prop-2-enoic acid (PubChem CID 3710207) has the molecular formula C21H24O4S and a molecular weight of 372.49 g/mol. Its IUPAC name is 3-[3-methoxy-4-[4-(4-methylphenyl)sulfanylbutoxy]phenyl]prop-2-enoic acid.
| Compound Name | 3-[3-methoxy-4-[4-(4-methylphenyl)sulfanylbutoxy]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 3710207 |
| Molecular Formula | C21H24O4S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 3-[3-methoxy-4-[4-(4-methylphenyl)sulfanylbutoxy]phenyl]prop-2-enoic acid |
| SMILES | COc1cc(C=CC(=O)O)ccc1OCCCCSc1ccc(C)cc1 |
| InChI | InChI=1S/C21H24O4S/c1-16-5-9-18(10-6-16)26-14-4-3-13-25-19-11-7-17(8-12-21(22)23)15-20(19)24-2/h5-12,15H,3-4,13-14H2,1-2H3,(H,22,23) |
| InChIKey | IOLNHRREQKGLSE-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|