C18H18O4 — CID 42314643
(E)-3-[3-methoxy-4-[(3-methylphenyl)methoxy]phenyl]prop-2-enoic acid (PubChem CID 42314643) has the molecular formula C18H18O4 and a molecular weight of 298.34 g/mol. Its IUPAC name is (E)-3-[3-methoxy-4-[(3-methylphenyl)methoxy]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-methoxy-4-[(3-methylphenyl)methoxy]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 42314643 |
| Molecular Formula | C18H18O4 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | (E)-3-[3-methoxy-4-[(3-methylphenyl)methoxy]phenyl]prop-2-enoic acid |
| SMILES | COc1cc(/C=C/C(=O)O)ccc1OCc1cccc(C)c1 |
| InChI | InChI=1S/C18H18O4/c1-13-4-3-5-15(10-13)12-22-16-8-6-14(7-9-18(19)20)11-17(16)21-2/h3-11H,12H2,1-2H3,(H,19,20)/b9-7+ |
| InChIKey | AUTMVTHGSQRRAC-VQHVLOKHSA-N |
| XLogP | 3.68 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|