C18H18O4 — CID 2478599
(Z)-3-(3-ethoxy-4-phenylmethoxyphenyl)prop-2-enoic acid (PubChem CID 2478599) has the molecular formula C18H18O4 and a molecular weight of 298.34 g/mol. Its IUPAC name is (Z)-3-(3-ethoxy-4-phenylmethoxyphenyl)prop-2-enoic acid.
| Compound Name | (Z)-3-(3-ethoxy-4-phenylmethoxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 2478599 |
| Molecular Formula | C18H18O4 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | (Z)-3-(3-ethoxy-4-phenylmethoxyphenyl)prop-2-enoic acid |
| SMILES | CCOc1cc(/C=C\C(=O)O)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C18H18O4/c1-2-21-17-12-14(9-11-18(19)20)8-10-16(17)22-13-15-6-4-3-5-7-15/h3-12H,2,13H2,1H3,(H,19,20)/b11-9- |
| InChIKey | ZRGFXHPPBGPRIU-LUAWRHEFSA-N |
| XLogP | 3.76 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|