C16H14O4 — CID 89404903
(E)-3-(4-hydroxy-3-phenylmethoxyphenyl)prop-2-enoic acid (PubChem CID 89404903) has the molecular formula C16H14O4 and a molecular weight of 270.28 g/mol. Its IUPAC name is (E)-3-(4-hydroxy-3-phenylmethoxyphenyl)prop-2-enoic acid.
| Compound Name | (E)-3-(4-hydroxy-3-phenylmethoxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 89404903 |
| Molecular Formula | C16H14O4 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | (E)-3-(4-hydroxy-3-phenylmethoxyphenyl)prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(O)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C16H14O4/c17-14-8-6-12(7-9-16(18)19)10-15(14)20-11-13-4-2-1-3-5-13/h1-10,17H,11H2,(H,18,19)/b9-7+ |
| InChIKey | SUPUCNVSRPQESH-VQHVLOKHSA-N |
| XLogP | 3.07 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|