C38H32O6 — CID 11250218
(1Z,4E)-5-[3,4-bis(phenylmethoxy)phenyl]-1-hydroxy-1-(2-hydroxy-6-phenylmethoxyphenyl)penta-1,4-dien-3-one (PubChem CID 11250218) has the molecular formula C38H32O6 and a molecular weight of 584.67 g/mol. Its IUPAC name is (1Z,4E)-5-[3,4-bis(phenylmethoxy)phenyl]-1-hydroxy-1-(2-hydroxy-6-phenylmethoxyphenyl)penta-1,4-dien-3-one.
| Compound Name | (1Z,4E)-5-[3,4-bis(phenylmethoxy)phenyl]-1-hydroxy-1-(2-hydroxy-6-phenylmethoxyphenyl)penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 11250218 |
| Molecular Formula | C38H32O6 |
| Molecular Weight | 584.67 g/mol |
| Exact Mass | 584.22 |
| IUPAC Name | (1Z,4E)-5-[3,4-bis(phenylmethoxy)phenyl]-1-hydroxy-1-(2-hydroxy-6-phenylmethoxyphenyl)penta-1,4-dien-3-one |
| SMILES | O=C(/C=C(\O)c1c(O)cccc1OCc1ccccc1)/C=C/c1ccc(OCc2ccccc2)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C38H32O6/c39-32(24-34(41)38-33(40)17-10-18-36(38)43-26-30-13-6-2-7-14-30)21-19-28-20-22-35(42-25-29-11-4-1-5-12-29)37(23-28)44-27-31-15-8-3-9-16-31/h1-24,40-41H,25-27H2/b21-19+,34-24- |
| InChIKey | DEQWASCIKDLKDT-LLHVTQKPSA-N |
| XLogP | 8.31 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.67 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|