C19H18O4 — CID 171390733
(1Z,4E)-5-(3-ethoxy-4-hydroxyphenyl)-1-hydroxy-1-phenylpenta-1,4-dien-3-one (PubChem CID 171390733) has the molecular formula C19H18O4 and a molecular weight of 310.35 g/mol. Its IUPAC name is (1Z,4E)-5-(3-ethoxy-4-hydroxyphenyl)-1-hydroxy-1-phenylpenta-1,4-dien-3-one.
| Compound Name | (1Z,4E)-5-(3-ethoxy-4-hydroxyphenyl)-1-hydroxy-1-phenylpenta-1,4-dien-3-one |
|---|---|
| PubChem CID | 171390733 |
| Molecular Formula | C19H18O4 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | (1Z,4E)-5-(3-ethoxy-4-hydroxyphenyl)-1-hydroxy-1-phenylpenta-1,4-dien-3-one |
| SMILES | CCOc1cc(/C=C/C(=O)/C=C(\O)c2ccccc2)ccc1O |
| InChI | InChI=1S/C19H18O4/c1-2-23-19-12-14(9-11-17(19)21)8-10-16(20)13-18(22)15-6-4-3-5-7-15/h3-13,21-22H,2H2,1H3/b10-8+,18-13- |
| InChIKey | AHRQRUJZLDRSHR-FUIQUSNNSA-N |
| XLogP | 3.97 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|