C17H18O3S — CID 34049038
(E)-3-(3-ethoxy-4-hydroxyphenyl)-1-(5-ethylthiophen-2-yl)prop-2-en-1-one (PubChem CID 34049038) has the molecular formula C17H18O3S and a molecular weight of 302.40 g/mol. Its IUPAC name is (E)-3-(3-ethoxy-4-hydroxyphenyl)-1-(5-ethylthiophen-2-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(3-ethoxy-4-hydroxyphenyl)-1-(5-ethylthiophen-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 34049038 |
| Molecular Formula | C17H18O3S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | (E)-3-(3-ethoxy-4-hydroxyphenyl)-1-(5-ethylthiophen-2-yl)prop-2-en-1-one |
| SMILES | CCOc1cc(/C=C/C(=O)c2ccc(CC)s2)ccc1O |
| InChI | InChI=1S/C17H18O3S/c1-3-13-7-10-17(21-13)15(19)9-6-12-5-8-14(18)16(11-12)20-4-2/h5-11,18H,3-4H2,1-2H3/b9-6+ |
| InChIKey | JPWKFNAWBGRLKT-RMKNXTFCSA-N |
| XLogP | 4.31 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|