C26H28O4S — CID 19557145
(E)-3-[4-[(3,4-diethoxyphenyl)methoxy]phenyl]-1-(5-ethylthiophen-2-yl)prop-2-en-1-one (PubChem CID 19557145) has the molecular formula C26H28O4S and a molecular weight of 436.57 g/mol. Its IUPAC name is (E)-3-[4-[(3,4-diethoxyphenyl)methoxy]phenyl]-1-(5-ethylthiophen-2-yl)prop-2-en-1-one.
| Compound Name | (E)-3-[4-[(3,4-diethoxyphenyl)methoxy]phenyl]-1-(5-ethylthiophen-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19557145 |
| Molecular Formula | C26H28O4S |
| Molecular Weight | 436.57 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | (E)-3-[4-[(3,4-diethoxyphenyl)methoxy]phenyl]-1-(5-ethylthiophen-2-yl)prop-2-en-1-one |
| SMILES | CCOc1ccc(COc2ccc(/C=C/C(=O)c3ccc(CC)s3)cc2)cc1OCC |
| InChI | InChI=1S/C26H28O4S/c1-4-22-13-16-26(31-22)23(27)14-9-19-7-11-21(12-8-19)30-18-20-10-15-24(28-5-2)25(17-20)29-6-3/h7-17H,4-6,18H2,1-3H3/b14-9+ |
| InChIKey | KMJSODRQTIHAMW-NTEUORMPSA-N |
| XLogP | 6.58 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.57 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|