C30H28O4S — CID 19563046
(E)-1-(5-benzylthiophen-2-yl)-3-[3-[(2-ethoxyphenoxy)methyl]-4-methoxyphenyl]prop-2-en-1-one (PubChem CID 19563046) has the molecular formula C30H28O4S and a molecular weight of 484.62 g/mol. Its IUPAC name is (E)-1-(5-benzylthiophen-2-yl)-3-[3-[(2-ethoxyphenoxy)methyl]-4-methoxyphenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(5-benzylthiophen-2-yl)-3-[3-[(2-ethoxyphenoxy)methyl]-4-methoxyphenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19563046 |
| Molecular Formula | C30H28O4S |
| Molecular Weight | 484.62 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | (E)-1-(5-benzylthiophen-2-yl)-3-[3-[(2-ethoxyphenoxy)methyl]-4-methoxyphenyl]prop-2-en-1-one |
| SMILES | CCOc1ccccc1OCc1cc(/C=C/C(=O)c2ccc(Cc3ccccc3)s2)ccc1OC |
| InChI | InChI=1S/C30H28O4S/c1-3-33-28-11-7-8-12-29(28)34-21-24-19-23(14-17-27(24)32-2)13-16-26(31)30-18-15-25(35-30)20-22-9-5-4-6-10-22/h4-19H,3,20-21H2,1-2H3/b16-13+ |
| InChIKey | QKYDFHZUVVCERC-DTQAZKPQSA-N |
| XLogP | 7.22 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.62 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|