C17H18O3S — CID 4775209
3-[4-methoxy-3-(methoxymethyl)phenyl]-1-(5-methylthiophen-2-yl)prop-2-en-1-one (PubChem CID 4775209) has the molecular formula C17H18O3S and a molecular weight of 302.40 g/mol. Its IUPAC name is 3-[4-methoxy-3-(methoxymethyl)phenyl]-1-(5-methylthiophen-2-yl)prop-2-en-1-one.
| Compound Name | 3-[4-methoxy-3-(methoxymethyl)phenyl]-1-(5-methylthiophen-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 4775209 |
| Molecular Formula | C17H18O3S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 3-[4-methoxy-3-(methoxymethyl)phenyl]-1-(5-methylthiophen-2-yl)prop-2-en-1-one |
| SMILES | COCc1cc(C=CC(=O)c2ccc(C)s2)ccc1OC |
| InChI | InChI=1S/C17H18O3S/c1-12-4-9-17(21-12)15(18)7-5-13-6-8-16(20-3)14(10-13)11-19-2/h4-10H,11H2,1-3H3 |
| InChIKey | NWNILFTVNIAFSA-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|